C13H22N2S2 — CID 80626828
N-[1-(thian-2-yl)-2-(1,3-thiazol-2-yl)ethyl]propan-1-amine (PubChem CID 80626828) has the molecular formula C13H22N2S2 and a molecular weight of 270.47 g/mol. Its IUPAC name is N-[1-(thian-2-yl)-2-(1,3-thiazol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(thian-2-yl)-2-(1,3-thiazol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 80626828 |
| Molecular Formula | C13H22N2S2 |
| Molecular Weight | 270.47 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-[1-(thian-2-yl)-2-(1,3-thiazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1nccs1)C1CCCCS1 |
| InChI | InChI=1S/C13H22N2S2/c1-2-6-14-11(10-13-15-7-9-17-13)12-5-3-4-8-16-12/h7,9,11-12,14H,2-6,8,10H2,1H3 |
| InChIKey | SLULCWFWTOMMQE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |