C16H23Cl2NS — CID 80626945
N-[2-(2,4-dichlorophenyl)-1-(thian-2-yl)ethyl]propan-1-amine (PubChem CID 80626945) has the molecular formula C16H23Cl2NS and a molecular weight of 332.34 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)-1-(thian-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(2,4-dichlorophenyl)-1-(thian-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 80626945 |
| Molecular Formula | C16H23Cl2NS |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)-1-(thian-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccc(Cl)cc1Cl)C1CCCCS1 |
| InChI | InChI=1S/C16H23Cl2NS/c1-2-8-19-15(16-5-3-4-9-20-16)10-12-6-7-13(17)11-14(12)18/h6-7,11,15-16,19H,2-5,8-10H2,1H3 |
| InChIKey | DRIGNGPHSCBNFS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |