C13H24N2OS — CID 10515255
N-[(1R,2S)-1-tert-butylsulfanyl-2-cyanobutyl]butanamide (PubChem CID 10515255) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is N-[(1R,2S)-1-tert-butylsulfanyl-2-cyanobutyl]butanamide.
| Compound Name | N-[(1R,2S)-1-tert-butylsulfanyl-2-cyanobutyl]butanamide |
|---|---|
| PubChem CID | 10515255 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-[(1R,2S)-1-tert-butylsulfanyl-2-cyanobutyl]butanamide |
| SMILES | CCCC(=O)N[C@H](SC(C)(C)C)[C@H](C#N)CC |
| InChI | InChI=1S/C13H24N2OS/c1-6-8-11(16)15-12(10(7-2)9-14)17-13(3,4)5/h10,12H,6-8H2,1-5H3,(H,15,16)/t10-,12+/m0/s1 |
| InChIKey | ZJENVFNZMMKHGD-CMPLNLGQSA-N |
| XLogP | 3.31 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|