C10H17N3 — CID 105153472
1-(1,5-dimethylpyrazol-4-yl)pent-4-en-1-amine (PubChem CID 105153472) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-4-yl)pent-4-en-1-amine.
| Compound Name | 1-(1,5-dimethylpyrazol-4-yl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 105153472 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-4-yl)pent-4-en-1-amine |
| SMILES | C=CCCC(N)c1cnn(C)c1C |
| InChI | InChI=1S/C10H17N3/c1-4-5-6-10(11)9-7-12-13(3)8(9)2/h4,7,10H,1,5-6,11H2,2-3H3 |
| InChIKey | ALTFIYJIPPMMNP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|