C7H13N3O — CID 96635093
(1S)-2-amino-1-(1,5-dimethylpyrazol-4-yl)ethanol (PubChem CID 96635093) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is (1S)-2-amino-1-(1,5-dimethylpyrazol-4-yl)ethanol.
| Compound Name | (1S)-2-amino-1-(1,5-dimethylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 96635093 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (1S)-2-amino-1-(1,5-dimethylpyrazol-4-yl)ethanol |
| SMILES | Cc1c([C@H](O)CN)cnn1C |
| InChI | InChI=1S/C7H13N3O/c1-5-6(7(11)3-8)4-9-10(5)2/h4,7,11H,3,8H2,1-2H3/t7-/m1/s1 |
| InChIKey | LFQVYMPJTSJFIA-SSDOTTSWSA-N |
| XLogP | -0.28 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |