C11H21N3O — CID 79595137
2-(aminomethyl)-1-(1,5-dimethylpyrazol-4-yl)pentan-1-ol (PubChem CID 79595137) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(1,5-dimethylpyrazol-4-yl)pentan-1-ol.
| Compound Name | 2-(aminomethyl)-1-(1,5-dimethylpyrazol-4-yl)pentan-1-ol |
|---|---|
| PubChem CID | 79595137 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 2-(aminomethyl)-1-(1,5-dimethylpyrazol-4-yl)pentan-1-ol |
| SMILES | CCCC(CN)C(O)c1cnn(C)c1C |
| InChI | InChI=1S/C11H21N3O/c1-4-5-9(6-12)11(15)10-7-13-14(3)8(10)2/h7,9,11,15H,4-6,12H2,1-3H3 |
| InChIKey | SPSGGMZJEZBZES-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |