C8H11N3O2 — CID 171871617
3-(1,5-dimethylpyrazol-4-yl)-2,3-dihydroxypropanenitrile (PubChem CID 171871617) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 3-(1,5-dimethylpyrazol-4-yl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(1,5-dimethylpyrazol-4-yl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171871617 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-(1,5-dimethylpyrazol-4-yl)-2,3-dihydroxypropanenitrile |
| SMILES | Cc1c(C(O)C(O)C#N)cnn1C |
| InChI | InChI=1S/C8H11N3O2/c1-5-6(4-10-11(5)2)8(13)7(12)3-9/h4,7-8,12-13H,1-2H3 |
| InChIKey | ILGXUSPAJAPQPR-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|