C12H19NS2 — CID 105153997
N-methyl-2-(thian-4-yl)-1-thiophen-3-ylethanamine (PubChem CID 105153997) has the molecular formula C12H19NS2 and a molecular weight of 241.42 g/mol. Its IUPAC name is N-methyl-2-(thian-4-yl)-1-thiophen-3-ylethanamine.
| Compound Name | N-methyl-2-(thian-4-yl)-1-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 105153997 |
| Molecular Formula | C12H19NS2 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-methyl-2-(thian-4-yl)-1-thiophen-3-ylethanamine |
| SMILES | CNC(CC1CCSCC1)c1ccsc1 |
| InChI | InChI=1S/C12H19NS2/c1-13-12(11-4-7-15-9-11)8-10-2-5-14-6-3-10/h4,7,9-10,12-13H,2-3,5-6,8H2,1H3 |
| InChIKey | MPNGWXSEADLMHO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |