C12H21NO5 — CID 10515423
tert-butyl (2R,3S)-2-formyl-3-(methoxymethoxy)pyrrolidine-1-carboxylate (PubChem CID 10515423) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-formyl-3-(methoxymethoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-2-formyl-3-(methoxymethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10515423 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | tert-butyl (2R,3S)-2-formyl-3-(methoxymethoxy)pyrrolidine-1-carboxylate |
| SMILES | COCO[C@H]1CCN(C(=O)OC(C)(C)C)[C@H]1C=O |
| InChI | InChI=1S/C12H21NO5/c1-12(2,3)18-11(15)13-6-5-10(9(13)7-14)17-8-16-4/h7,9-10H,5-6,8H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | FQCPFPNRSZCUOM-UWVGGRQHSA-N |
| XLogP | 1.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|