C10H17NO4 — CID 59926653
tert-butyl (2S,3S)-2-formyl-3-hydroxypyrrolidine-1-carboxylate (PubChem CID 59926653) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-formyl-3-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-2-formyl-3-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59926653 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | tert-butyl (2S,3S)-2-formyl-3-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](O)[C@H]1C=O |
| InChI | InChI=1S/C10H17NO4/c1-10(2,3)15-9(14)11-5-4-8(13)7(11)6-12/h6-8,13H,4-5H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | IHIFFKSILFLWQG-SFYZADRCSA-N |
| XLogP | 0.56 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|