C13H22N2O5 — CID 3063137
tert-butyl N-[(2S)-1-[(2S)-2-formylpyrrolidin-1-yl]-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 3063137) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[(2S)-2-formylpyrrolidin-1-yl]-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[(2S)-2-formylpyrrolidin-1-yl]-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 3063137 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-[(2S)-2-formylpyrrolidin-1-yl]-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C=O |
| InChI | InChI=1S/C13H22N2O5/c1-13(2,3)20-12(19)14-10(8-17)11(18)15-6-4-5-9(15)7-16/h7,9-10,17H,4-6,8H2,1-3H3,(H,14,19)/t9-,10-/m0/s1 |
| InChIKey | KLYLXGWOTSHUQO-UWVGGRQHSA-N |
| XLogP | 0.06 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|