C19H30N2O5 — CID 143826559
tert-butyl N-[1-[(2S)-2-formylpyrrolidin-1-yl]-7-methyl-1,5-dioxooct-6-en-2-yl]carbamate (PubChem CID 143826559) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl N-[1-[(2S)-2-formylpyrrolidin-1-yl]-7-methyl-1,5-dioxooct-6-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2S)-2-formylpyrrolidin-1-yl]-7-methyl-1,5-dioxooct-6-en-2-yl]carbamate |
|---|---|
| PubChem CID | 143826559 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl N-[1-[(2S)-2-formylpyrrolidin-1-yl]-7-methyl-1,5-dioxooct-6-en-2-yl]carbamate |
| SMILES | CC(C)=CC(=O)CCC(NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1C=O |
| InChI | InChI=1S/C19H30N2O5/c1-13(2)11-15(23)8-9-16(20-18(25)26-19(3,4)5)17(24)21-10-6-7-14(21)12-22/h11-12,14,16H,6-10H2,1-5H3,(H,20,25)/t14-,16?/m0/s1 |
| InChIKey | BJSPKQZSDCAZDJ-LBAUFKAWSA-N |
| XLogP | 2.39 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|