C19H31N3O5 — CID 70261060
tert-butyl N-[(E,2S)-1-(2-carbamoylpyrrolidin-1-yl)-6-methyl-1,5-dioxooct-6-en-2-yl]carbamate (PubChem CID 70261060) has the molecular formula C19H31N3O5 and a molecular weight of 381.47 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-1-(2-carbamoylpyrrolidin-1-yl)-6-methyl-1,5-dioxooct-6-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S)-1-(2-carbamoylpyrrolidin-1-yl)-6-methyl-1,5-dioxooct-6-en-2-yl]carbamate |
|---|---|
| PubChem CID | 70261060 |
| Molecular Formula | C19H31N3O5 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | tert-butyl N-[(E,2S)-1-(2-carbamoylpyrrolidin-1-yl)-6-methyl-1,5-dioxooct-6-en-2-yl]carbamate |
| SMILES | C/C=C(\C)C(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCCC1C(N)=O |
| InChI | InChI=1S/C19H31N3O5/c1-6-12(2)15(23)10-9-13(21-18(26)27-19(3,4)5)17(25)22-11-7-8-14(22)16(20)24/h6,13-14H,7-11H2,1-5H3,(H2,20,24)(H,21,26)/b12-6+/t13-,14?/m0/s1 |
| InChIKey | HCWDAMANTDFBRJ-IOYOSXTHSA-N |
| XLogP | 1.67 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|