C16H28N4O5 — CID 90878604
tert-butyl N-[(2S)-1-(2-carbamoylpyrrolidin-1-yl)-1-oxo-3-(prop-1-en-2-ylamino)oxypropan-2-yl]carbamate (PubChem CID 90878604) has the molecular formula C16H28N4O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-carbamoylpyrrolidin-1-yl)-1-oxo-3-(prop-1-en-2-ylamino)oxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-carbamoylpyrrolidin-1-yl)-1-oxo-3-(prop-1-en-2-ylamino)oxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 90878604 |
| Molecular Formula | C16H28N4O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-carbamoylpyrrolidin-1-yl)-1-oxo-3-(prop-1-en-2-ylamino)oxypropan-2-yl]carbamate |
| SMILES | C=C(C)NOC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCCC1C(N)=O |
| InChI | InChI=1S/C16H28N4O5/c1-10(2)19-24-9-11(18-15(23)25-16(3,4)5)14(22)20-8-6-7-12(20)13(17)21/h11-12,19H,1,6-9H2,2-5H3,(H2,17,21)(H,18,23)/t11-,12?/m0/s1 |
| InChIKey | XTJHIDFLUSZQHD-PXYINDEMSA-N |
| XLogP | 0.41 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|