C24H39N3O5 — CID 89084433
tert-butyl N-[(Z,2S)-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-9-[(2S)-2-(1-hydroxyethenyl)cyclopropyl]-1-oxonon-8-en-2-yl]carbamate (PubChem CID 89084433) has the molecular formula C24H39N3O5 and a molecular weight of 449.59 g/mol. Its IUPAC name is tert-butyl N-[(Z,2S)-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-9-[(2S)-2-(1-hydroxyethenyl)cyclopropyl]-1-oxonon-8-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(Z,2S)-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-9-[(2S)-2-(1-hydroxyethenyl)cyclopropyl]-1-oxonon-8-en-2-yl]carbamate |
|---|---|
| PubChem CID | 89084433 |
| Molecular Formula | C24H39N3O5 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | tert-butyl N-[(Z,2S)-1-[(2S)-2-carbamoylpyrrolidin-1-yl]-9-[(2S)-2-(1-hydroxyethenyl)cyclopropyl]-1-oxonon-8-en-2-yl]carbamate |
| SMILES | C=C(O)[C@H]1CC1/C=C\CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1C(N)=O |
| InChI | InChI=1S/C24H39N3O5/c1-16(28)18-15-17(18)11-8-6-5-7-9-12-19(26-23(31)32-24(2,3)4)22(30)27-14-10-13-20(27)21(25)29/h8,11,17-20,28H,1,5-7,9-10,12-15H2,2-4H3,(H2,25,29)(H,26,31)/b11-8-/t17?,18-,19+,20+/m1/s1 |
| InChIKey | IFIUSEUBOJBFDY-YCYBWTLOSA-N |
| XLogP | 3.57 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|