C19H33N5O5 — CID 123748829
tert-butyl N-[1-(2-carbamoylpyrrolidin-1-yl)-3-[4-(dimethylamino)but-2-enoylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 123748829) has the molecular formula C19H33N5O5 and a molecular weight of 411.50 g/mol. Its IUPAC name is tert-butyl N-[1-(2-carbamoylpyrrolidin-1-yl)-3-[4-(dimethylamino)but-2-enoylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-carbamoylpyrrolidin-1-yl)-3-[4-(dimethylamino)but-2-enoylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 123748829 |
| Molecular Formula | C19H33N5O5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | tert-butyl N-[1-(2-carbamoylpyrrolidin-1-yl)-3-[4-(dimethylamino)but-2-enoylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CN(C)CC=CC(=O)NCC(NC(=O)OC(C)(C)C)C(=O)N1CCCC1C(N)=O |
| InChI | InChI=1S/C19H33N5O5/c1-19(2,3)29-18(28)22-13(12-21-15(25)9-7-10-23(4)5)17(27)24-11-6-8-14(24)16(20)26/h7,9,13-14H,6,8,10-12H2,1-5H3,(H2,20,26)(H,21,25)(H,22,28) |
| InChIKey | YOBQCAHNKQACEV-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|