C26H45N3O6 — CID 71023507
ethyl (Z,4S,12S)-13-[(2S)-2-carbamoylpyrrolidin-1-yl]-4-methyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-13-oxotridec-5-enoate (PubChem CID 71023507) has the molecular formula C26H45N3O6 and a molecular weight of 495.66 g/mol. Its IUPAC name is ethyl (Z,4S,12S)-13-[(2S)-2-carbamoylpyrrolidin-1-yl]-4-methyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-13-oxotridec-5-enoate.
| Compound Name | ethyl (Z,4S,12S)-13-[(2S)-2-carbamoylpyrrolidin-1-yl]-4-methyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-13-oxotridec-5-enoate |
|---|---|
| PubChem CID | 71023507 |
| Molecular Formula | C26H45N3O6 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | ethyl (Z,4S,12S)-13-[(2S)-2-carbamoylpyrrolidin-1-yl]-4-methyl-12-[(2-methylpropan-2-yl)oxycarbonylamino]-13-oxotridec-5-enoate |
| SMILES | CCOC(=O)CC[C@H](C)/C=C\CCCCC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1C(N)=O |
| InChI | InChI=1S/C26H45N3O6/c1-6-34-22(30)17-16-19(2)13-10-8-7-9-11-14-20(28-25(33)35-26(3,4)5)24(32)29-18-12-15-21(29)23(27)31/h10,13,19-21H,6-9,11-12,14-18H2,1-5H3,(H2,27,31)(H,28,33)/b13-10-/t19-,20+,21+/m1/s1 |
| InChIKey | LIVWORVAHUJHAS-UQQGDEJGSA-N |
| XLogP | 3.84 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|