C24H45N7O5 — CID 10649402
tert-butyl N-[(2R)-1-[(2S)-2-[[(2R)-1-amino-1-oxopropan-2-yl]carbamoyl]pyrrolidin-1-yl]-6-[bis(ethylamino)methylideneamino]-1-oxohexan-2-yl]carbamate (PubChem CID 10649402) has the molecular formula C24H45N7O5 and a molecular weight of 511.67 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[(2S)-2-[[(2R)-1-amino-1-oxopropan-2-yl]carbamoyl]pyrrolidin-1-yl]-6-[bis(ethylamino)methylideneamino]-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[(2S)-2-[[(2R)-1-amino-1-oxopropan-2-yl]carbamoyl]pyrrolidin-1-yl]-6-[bis(ethylamino)methylideneamino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 10649402 |
| Molecular Formula | C24H45N7O5 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.35 |
| IUPAC Name | tert-butyl N-[(2R)-1-[(2S)-2-[[(2R)-1-amino-1-oxopropan-2-yl]carbamoyl]pyrrolidin-1-yl]-6-[bis(ethylamino)methylideneamino]-1-oxohexan-2-yl]carbamate |
| SMILES | CCNC(=NCCCC[C@@H](NC(=O)OC(C)(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@H](C)C(N)=O)NCC |
| InChI | InChI=1S/C24H45N7O5/c1-7-26-22(27-8-2)28-14-10-9-12-17(30-23(35)36-24(4,5)6)21(34)31-15-11-13-18(31)20(33)29-16(3)19(25)32/h16-18H,7-15H2,1-6H3,(H2,25,32)(H,29,33)(H,30,35)(H2,26,27,28)/t16-,17-,18+/m1/s1 |
| InChIKey | IQKIOZJPZGSKSY-KURKYZTESA-N |
| XLogP | 0.61 |
| TPSA | 167.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|