C13H24F3NS — CID 105156308
5,5,5-trifluoro-N-propyl-1-(thian-4-yl)pentan-2-amine (PubChem CID 105156308) has the molecular formula C13H24F3NS and a molecular weight of 283.40 g/mol. Its IUPAC name is 5,5,5-trifluoro-N-propyl-1-(thian-4-yl)pentan-2-amine.
| Compound Name | 5,5,5-trifluoro-N-propyl-1-(thian-4-yl)pentan-2-amine |
|---|---|
| PubChem CID | 105156308 |
| Molecular Formula | C13H24F3NS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 5,5,5-trifluoro-N-propyl-1-(thian-4-yl)pentan-2-amine |
| SMILES | CCCNC(CCC(F)(F)F)CC1CCSCC1 |
| InChI | InChI=1S/C13H24F3NS/c1-2-7-17-12(3-6-13(14,15)16)10-11-4-8-18-9-5-11/h11-12,17H,2-10H2,1H3 |
| InChIKey | VXVSRNJKJVAPEQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |