C10H17N3OS — CID 105156646
4-(oxolan-2-yl)-1-(1,2,5-thiadiazol-3-yl)butan-1-amine (PubChem CID 105156646) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 4-(oxolan-2-yl)-1-(1,2,5-thiadiazol-3-yl)butan-1-amine.
| Compound Name | 4-(oxolan-2-yl)-1-(1,2,5-thiadiazol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 105156646 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(oxolan-2-yl)-1-(1,2,5-thiadiazol-3-yl)butan-1-amine |
| SMILES | NC(CCCC1CCCO1)c1cnsn1 |
| InChI | InChI=1S/C10H17N3OS/c11-9(10-7-12-15-13-10)5-1-3-8-4-2-6-14-8/h7-9H,1-6,11H2 |
| InChIKey | KNHHHFPNMPJYRM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |