C12H15ClN4S — CID 105157384
2-(3-chloro-4-pyridinyl)-N-ethyl-1-(4-methylthiadiazol-5-yl)ethanamine (PubChem CID 105157384) has the molecular formula C12H15ClN4S and a molecular weight of 282.80 g/mol. Its IUPAC name is 2-(3-chloro-4-pyridinyl)-N-ethyl-1-(4-methylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(3-chloro-4-pyridinyl)-N-ethyl-1-(4-methylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105157384 |
| Molecular Formula | C12H15ClN4S |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-(3-chloro-4-pyridinyl)-N-ethyl-1-(4-methylthiadiazol-5-yl)ethanamine |
| SMILES | CCNC(Cc1ccncc1Cl)c1snnc1C |
| InChI | InChI=1S/C12H15ClN4S/c1-3-15-11(12-8(2)16-17-18-12)6-9-4-5-14-7-10(9)13/h4-5,7,11,15H,3,6H2,1-2H3 |
| InChIKey | LLFUKNSUDQSDKG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |