C11H13ClN4S — CID 105157299
2-(3-chloro-4-pyridinyl)-1-(4-ethylthiadiazol-5-yl)ethanamine (PubChem CID 105157299) has the molecular formula C11H13ClN4S and a molecular weight of 268.77 g/mol. Its IUPAC name is 2-(3-chloro-4-pyridinyl)-1-(4-ethylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(3-chloro-4-pyridinyl)-1-(4-ethylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105157299 |
| Molecular Formula | C11H13ClN4S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(3-chloro-4-pyridinyl)-1-(4-ethylthiadiazol-5-yl)ethanamine |
| SMILES | CCc1nnsc1C(N)Cc1ccncc1Cl |
| InChI | InChI=1S/C11H13ClN4S/c1-2-10-11(17-16-15-10)9(13)5-7-3-4-14-6-8(7)12/h3-4,6,9H,2,5,13H2,1H3 |
| InChIKey | YXCMMQIUILMEJA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |