C12H13ClFN3S — CID 102866349
2-(3-chloro-2-fluorophenyl)-1-(4-ethylthiadiazol-5-yl)ethanamine (PubChem CID 102866349) has the molecular formula C12H13ClFN3S and a molecular weight of 285.78 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-1-(4-ethylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-1-(4-ethylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 102866349 |
| Molecular Formula | C12H13ClFN3S |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-1-(4-ethylthiadiazol-5-yl)ethanamine |
| SMILES | CCc1nnsc1C(N)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C12H13ClFN3S/c1-2-10-12(18-17-16-10)9(15)6-7-4-3-5-8(13)11(7)14/h3-5,9H,2,6,15H2,1H3 |
| InChIKey | ANWQTDUCCHKJIG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |