C14H20N2 — CID 105158304
N,N-dimethyl-4-[1-(propylamino)prop-2-ynyl]aniline (PubChem CID 105158304) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-(propylamino)prop-2-ynyl]aniline.
| Compound Name | N,N-dimethyl-4-[1-(propylamino)prop-2-ynyl]aniline |
|---|---|
| PubChem CID | 105158304 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N,N-dimethyl-4-[1-(propylamino)prop-2-ynyl]aniline |
| SMILES | C#CC(NCCC)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H20N2/c1-5-11-15-14(6-2)12-7-9-13(10-8-12)16(3)4/h2,7-10,14-15H,5,11H2,1,3-4H3 |
| InChIKey | LWZGHXLKUNIUNI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|