C14H26ClN3O — CID 105158790
1-(4-chloro-1,3-dimethylpyrazol-5-yl)-N-ethyl-4-propoxybutan-2-amine (PubChem CID 105158790) has the molecular formula C14H26ClN3O and a molecular weight of 287.83 g/mol. Its IUPAC name is 1-(4-chloro-1,3-dimethylpyrazol-5-yl)-N-ethyl-4-propoxybutan-2-amine.
| Compound Name | 1-(4-chloro-1,3-dimethylpyrazol-5-yl)-N-ethyl-4-propoxybutan-2-amine |
|---|---|
| PubChem CID | 105158790 |
| Molecular Formula | C14H26ClN3O |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 1-(4-chloro-1,3-dimethylpyrazol-5-yl)-N-ethyl-4-propoxybutan-2-amine |
| SMILES | CCCOCCC(Cc1c(Cl)c(C)nn1C)NCC |
| InChI | InChI=1S/C14H26ClN3O/c1-5-8-19-9-7-12(16-6-2)10-13-14(15)11(3)17-18(13)4/h12,16H,5-10H2,1-4H3 |
| InChIKey | ROCBHDMCMXJETK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|