C12H23BrN4O — CID 105317826
[1-(4-bromo-1,3-dimethylpyrazol-5-yl)-4-propoxybutan-2-yl]hydrazine (PubChem CID 105317826) has the molecular formula C12H23BrN4O and a molecular weight of 319.25 g/mol. Its IUPAC name is [1-(4-bromo-1,3-dimethylpyrazol-5-yl)-4-propoxybutan-2-yl]hydrazine.
| Compound Name | [1-(4-bromo-1,3-dimethylpyrazol-5-yl)-4-propoxybutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105317826 |
| Molecular Formula | C12H23BrN4O |
| Molecular Weight | 319.25 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [1-(4-bromo-1,3-dimethylpyrazol-5-yl)-4-propoxybutan-2-yl]hydrazine |
| SMILES | CCCOCCC(Cc1c(Br)c(C)nn1C)NN |
| InChI | InChI=1S/C12H23BrN4O/c1-4-6-18-7-5-10(15-14)8-11-12(13)9(2)16-17(11)3/h10,15H,4-8,14H2,1-3H3 |
| InChIKey | BNOTZORTAANPFZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|