C15H27BrN4 — CID 105317779
[1-(4-bromo-1,3-dimethylpyrazol-5-yl)-3-cycloheptylpropan-2-yl]hydrazine (PubChem CID 105317779) has the molecular formula C15H27BrN4 and a molecular weight of 343.31 g/mol. Its IUPAC name is [1-(4-bromo-1,3-dimethylpyrazol-5-yl)-3-cycloheptylpropan-2-yl]hydrazine.
| Compound Name | [1-(4-bromo-1,3-dimethylpyrazol-5-yl)-3-cycloheptylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105317779 |
| Molecular Formula | C15H27BrN4 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [1-(4-bromo-1,3-dimethylpyrazol-5-yl)-3-cycloheptylpropan-2-yl]hydrazine |
| SMILES | Cc1nn(C)c(CC(CC2CCCCCC2)NN)c1Br |
| InChI | InChI=1S/C15H27BrN4/c1-11-15(16)14(20(2)19-11)10-13(18-17)9-12-7-5-3-4-6-8-12/h12-13,18H,3-10,17H2,1-2H3 |
| InChIKey | RBALMGHJLULDFC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|