C10H19BrN4O — CID 105206328
[1-(4-bromo-1,3-dimethylpyrazol-5-yl)-4-methoxybutan-2-yl]hydrazine (PubChem CID 105206328) has the molecular formula C10H19BrN4O and a molecular weight of 291.19 g/mol. Its IUPAC name is [1-(4-bromo-1,3-dimethylpyrazol-5-yl)-4-methoxybutan-2-yl]hydrazine.
| Compound Name | [1-(4-bromo-1,3-dimethylpyrazol-5-yl)-4-methoxybutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105206328 |
| Molecular Formula | C10H19BrN4O |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | [1-(4-bromo-1,3-dimethylpyrazol-5-yl)-4-methoxybutan-2-yl]hydrazine |
| SMILES | COCCC(Cc1c(Br)c(C)nn1C)NN |
| InChI | InChI=1S/C10H19BrN4O/c1-7-10(11)9(15(2)14-7)6-8(13-12)4-5-16-3/h8,13H,4-6,12H2,1-3H3 |
| InChIKey | SRASQEVORJTFRT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|