C12H23BrN4O2 — CID 114033184
[1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-3-(2-methoxyethoxy)propan-2-yl]hydrazine (PubChem CID 114033184) has the molecular formula C12H23BrN4O2 and a molecular weight of 335.25 g/mol. Its IUPAC name is [1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-3-(2-methoxyethoxy)propan-2-yl]hydrazine.
| Compound Name | [1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-3-(2-methoxyethoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 114033184 |
| Molecular Formula | C12H23BrN4O2 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [1-(4-bromo-1-ethyl-3-methylpyrazol-5-yl)-3-(2-methoxyethoxy)propan-2-yl]hydrazine |
| SMILES | CCn1nc(C)c(Br)c1CC(COCCOC)NN |
| InChI | InChI=1S/C12H23BrN4O2/c1-4-17-11(12(13)9(2)16-17)7-10(15-14)8-19-6-5-18-3/h10,15H,4-8,14H2,1-3H3 |
| InChIKey | KHKCGRDFEOCOIJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|