C16H21N5 — CID 105160306
1-(1,5-dimethylpyrazol-4-yl)-2-(1-ethylindazol-3-yl)ethanamine (PubChem CID 105160306) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-4-yl)-2-(1-ethylindazol-3-yl)ethanamine.
| Compound Name | 1-(1,5-dimethylpyrazol-4-yl)-2-(1-ethylindazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 105160306 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-4-yl)-2-(1-ethylindazol-3-yl)ethanamine |
| SMILES | CCn1nc(CC(N)c2cnn(C)c2C)c2ccccc21 |
| InChI | InChI=1S/C16H21N5/c1-4-21-16-8-6-5-7-12(16)15(19-21)9-14(17)13-10-18-20(3)11(13)2/h5-8,10,14H,4,9,17H2,1-3H3 |
| InChIKey | FIVIYEDBQUXRGD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |