C13H18O6 — CID 10516168
(1R,4R,5S,7R,8S)-4,7-dihydroxy-7-pent-4-enyl-2,6,10-trioxatricyclo[6.3.0.01,5]undecan-9-one (PubChem CID 10516168) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is (1R,4R,5S,7R,8S)-4,7-dihydroxy-7-pent-4-enyl-2,6,10-trioxatricyclo[6.3.0.01,5]undecan-9-one.
| Compound Name | (1R,4R,5S,7R,8S)-4,7-dihydroxy-7-pent-4-enyl-2,6,10-trioxatricyclo[6.3.0.01,5]undecan-9-one |
|---|---|
| PubChem CID | 10516168 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (1R,4R,5S,7R,8S)-4,7-dihydroxy-7-pent-4-enyl-2,6,10-trioxatricyclo[6.3.0.01,5]undecan-9-one |
| SMILES | C=CCCC[C@@]1(O)O[C@H]2[C@H](O)CO[C@]23COC(=O)[C@@H]31 |
| InChI | InChI=1S/C13H18O6/c1-2-3-4-5-13(16)9-11(15)17-7-12(9)10(19-13)8(14)6-18-12/h2,8-10,14,16H,1,3-7H2/t8-,9+,10+,12+,13-/m1/s1 |
| InChIKey | WJGRKXJJOKLJRW-YTCQTTRASA-N |
| XLogP | -0.27 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|