C28H48O6 — CID 10528748
(3aR,6R,6aR)-3'-[(Z)-1-hydroxyoctadec-9-enyl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-oxolane]-2'-one (PubChem CID 10528748) has the molecular formula C28H48O6 and a molecular weight of 480.69 g/mol. Its IUPAC name is (3aR,6R,6aR)-3'-[(Z)-1-hydroxyoctadec-9-enyl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-oxolane]-2'-one.
| Compound Name | (3aR,6R,6aR)-3'-[(Z)-1-hydroxyoctadec-9-enyl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-oxolane]-2'-one |
|---|---|
| PubChem CID | 10528748 |
| Molecular Formula | C28H48O6 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | (3aR,6R,6aR)-3'-[(Z)-1-hydroxyoctadec-9-enyl]-2,2-dimethylspiro[5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole-6,5'-oxolane]-2'-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(O)C1C[C@]2(CO[C@@H]3OC(C)(C)O[C@@H]32)OC1=O |
| InChI | InChI=1S/C28H48O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(29)22-20-28(33-25(22)30)21-31-26-24(28)32-27(2,3)34-26/h11-12,22-24,26,29H,4-10,13-21H2,1-3H3/b12-11-/t22?,23?,24-,26+,28+/m0/s1 |
| InChIKey | CFKIXVQZBXSUFJ-WROJWPILSA-N |
| XLogP | 6.19 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|