C15H18O8 — CID 162981234
methyl (1R,4S,5S,6S,8R,10S,11S,14S)-6-hydroxy-11-[(1S)-1-hydroxyethyl]-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-ene-5-carboxylate (PubChem CID 162981234) has the molecular formula C15H18O8 and a molecular weight of 326.30 g/mol. Its IUPAC name is methyl (1R,4S,5S,6S,8R,10S,11S,14S)-6-hydroxy-11-[(1S)-1-hydroxyethyl]-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-ene-5-carboxylate.
| Compound Name | methyl (1R,4S,5S,6S,8R,10S,11S,14S)-6-hydroxy-11-[(1S)-1-hydroxyethyl]-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-ene-5-carboxylate |
|---|---|
| PubChem CID | 162981234 |
| Molecular Formula | C15H18O8 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | methyl (1R,4S,5S,6S,8R,10S,11S,14S)-6-hydroxy-11-[(1S)-1-hydroxyethyl]-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-ene-5-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2C=C[C@]34OC(=O)[C@@H]([C@H](C)O)[C@@H]3O[C@H](O[C@@H]1O)[C@@H]24 |
| InChI | InChI=1S/C15H18O8/c1-5(16)7-10-15(23-13(7)19)4-3-6-8(11(17)20-2)12(18)22-14(21-10)9(6)15/h3-10,12,14,16,18H,1-2H3/t5-,6+,7-,8+,9+,10-,12-,14+,15+/m0/s1 |
| InChIKey | VLBNONAQDKTJCU-ITZSIPTMSA-N |
| XLogP | -1.06 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|