C26H44O8 — CID 10874558
(5S)-5-[(2R,5S)-5-[(Z,1R,2S,3S,6R,7S,8R)-1,3-dihydroxy-7-methoxy-2,6-dimethyl-8-(2-methyl-1,3-dioxolan-2-yl)non-4-enyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one (PubChem CID 10874558) has the molecular formula C26H44O8 and a molecular weight of 484.63 g/mol. Its IUPAC name is (5S)-5-[(2R,5S)-5-[(Z,1R,2S,3S,6R,7S,8R)-1,3-dihydroxy-7-methoxy-2,6-dimethyl-8-(2-methyl-1,3-dioxolan-2-yl)non-4-enyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one.
| Compound Name | (5S)-5-[(2R,5S)-5-[(Z,1R,2S,3S,6R,7S,8R)-1,3-dihydroxy-7-methoxy-2,6-dimethyl-8-(2-methyl-1,3-dioxolan-2-yl)non-4-enyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 10874558 |
| Molecular Formula | C26H44O8 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | (5S)-5-[(2R,5S)-5-[(Z,1R,2S,3S,6R,7S,8R)-1,3-dihydroxy-7-methoxy-2,6-dimethyl-8-(2-methyl-1,3-dioxolan-2-yl)non-4-enyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one |
| SMILES | CO[C@@H]([C@H](C)/C=C\[C@H](O)[C@H](C)[C@@H](O)[C@]1(C)CC[C@H]([C@]2(C)CCC(=O)O2)O1)[C@@H](C)C1(C)OCCO1 |
| InChI | InChI=1S/C26H44O8/c1-16(22(30-7)18(3)26(6)31-14-15-32-26)8-9-19(27)17(2)23(29)25(5)12-10-20(33-25)24(4)13-11-21(28)34-24/h8-9,16-20,22-23,27,29H,10-15H2,1-7H3/b9-8-/t16-,17+,18-,19+,20-,22+,23-,24+,25+/m1/s1 |
| InChIKey | CWVOQBRVOHRBQY-SMQUYRHXSA-N |
| XLogP | 2.98 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|