C27H40O7 — CID 123965533
18-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl]octadeca-6,9,12-trienoic acid (PubChem CID 123965533) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is 18-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl]octadeca-6,9,12-trienoic acid.
| Compound Name | 18-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl]octadeca-6,9,12-trienoic acid |
|---|---|
| PubChem CID | 123965533 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 18-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl]octadeca-6,9,12-trienoic acid |
| SMILES | CC1(C)OCC(C2OC(=O)C(CCCCCC=CCC=CCC=CCCCCC(=O)O)C2=O)O1 |
| InChI | InChI=1S/C27H40O7/c1-27(2)32-20-22(34-27)25-24(30)21(26(31)33-25)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-23(28)29/h3,5-6,8-9,11,21-22,25H,4,7,10,12-20H2,1-2H3,(H,28,29) |
| InChIKey | GJICWRQAGSXGQE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|