C31H50O7 — CID 90756803
[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] 6-(2-methylpropyl)octadeca-9,12-dienoate (PubChem CID 90756803) has the molecular formula C31H50O7 and a molecular weight of 534.73 g/mol. Its IUPAC name is [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] 6-(2-methylpropyl)octadeca-9,12-dienoate.
| Compound Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] 6-(2-methylpropyl)octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 90756803 |
| Molecular Formula | C31H50O7 |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | [5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,4-dioxooxolan-3-yl] 6-(2-methylpropyl)octadeca-9,12-dienoate |
| SMILES | CCCCCC=CCC=CCCC(CCCCC(=O)OC1C(=O)OC(C2COC(C)(C)O2)C1=O)CC(C)C |
| InChI | InChI=1S/C31H50O7/c1-6-7-8-9-10-11-12-13-14-15-18-24(21-23(2)3)19-16-17-20-26(32)36-29-27(33)28(37-30(29)34)25-22-35-31(4,5)38-25/h10-11,13-14,23-25,28-29H,6-9,12,15-22H2,1-5H3 |
| InChIKey | TWJGARZCUMEESW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|