C17H24O7 — CID 134832495
ethyl (1S,6R)-6-[(3aR,5R)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 134832495) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is ethyl (1S,6R)-6-[(3aR,5R)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,6R)-6-[(3aR,5R)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134832495 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | ethyl (1S,6R)-6-[(3aR,5R)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C=CC[C@H]1[C@H]1O[C@@H]2OC(C)(C)OC2C1OC |
| InChI | InChI=1S/C17H24O7/c1-5-21-15(19)11-9(7-6-8-10(11)18)12-13(20-4)14-16(22-12)24-17(2,3)23-14/h6,8-9,11-14,16H,5,7H2,1-4H3/t9-,11+,12-,13?,14?,16-/m1/s1 |
| InChIKey | VICJLYOYXCPVJS-BCDWRYECSA-N |
| XLogP | 1.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|