C14H21N5 — CID 105162643
1-(2-propyl-1,2,4-triazol-3-yl)-4-pyridin-2-ylbutan-2-amine (PubChem CID 105162643) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 1-(2-propyl-1,2,4-triazol-3-yl)-4-pyridin-2-ylbutan-2-amine.
| Compound Name | 1-(2-propyl-1,2,4-triazol-3-yl)-4-pyridin-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 105162643 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 1-(2-propyl-1,2,4-triazol-3-yl)-4-pyridin-2-ylbutan-2-amine |
| SMILES | CCCn1ncnc1CC(N)CCc1ccccn1 |
| InChI | InChI=1S/C14H21N5/c1-2-9-19-14(17-11-18-19)10-12(15)6-7-13-5-3-4-8-16-13/h3-5,8,11-12H,2,6-7,9-10,15H2,1H3 |
| InChIKey | JNUZJNNKNOABIN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |