C14H19NS — CID 105163222
1-(2,3-dihydro-1-benzothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine (PubChem CID 105163222) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 105163222 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-3-yl)-N,3-dimethylbut-2-en-1-amine |
| SMILES | CNC(C=C(C)C)C1CSc2ccccc21 |
| InChI | InChI=1S/C14H19NS/c1-10(2)8-13(15-3)12-9-16-14-7-5-4-6-11(12)14/h4-8,12-13,15H,9H2,1-3H3 |
| InChIKey | IGTFYGWXOLUDGZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|