C9H19NO — CID 105163566
6-methoxy-2,5-dimethylhex-1-en-3-amine (PubChem CID 105163566) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is 6-methoxy-2,5-dimethylhex-1-en-3-amine.
| Compound Name | 6-methoxy-2,5-dimethylhex-1-en-3-amine |
|---|---|
| PubChem CID | 105163566 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 6-methoxy-2,5-dimethylhex-1-en-3-amine |
| SMILES | C=C(C)C(N)CC(C)COC |
| InChI | InChI=1S/C9H19NO/c1-7(2)9(10)5-8(3)6-11-4/h8-9H,1,5-6,10H2,2-4H3 |
| InChIKey | FMCXXSIZNUDYFJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|