C13H14BrClN2S — CID 105166826
N-[(4-bromothiophen-3-yl)-(3-chloro-4-pyridinyl)methyl]propan-1-amine (PubChem CID 105166826) has the molecular formula C13H14BrClN2S and a molecular weight of 345.69 g/mol. Its IUPAC name is N-[(4-bromothiophen-3-yl)-(3-chloro-4-pyridinyl)methyl]propan-1-amine.
| Compound Name | N-[(4-bromothiophen-3-yl)-(3-chloro-4-pyridinyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105166826 |
| Molecular Formula | C13H14BrClN2S |
| Molecular Weight | 345.69 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | N-[(4-bromothiophen-3-yl)-(3-chloro-4-pyridinyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccncc1Cl)c1cscc1Br |
| InChI | InChI=1S/C13H14BrClN2S/c1-2-4-17-13(10-7-18-8-11(10)14)9-3-5-16-6-12(9)15/h3,5-8,13,17H,2,4H2,1H3 |
| InChIKey | ZIHYNIYMVOJFAV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |