C14H13BrF3NS — CID 105010456
N-[(4-bromothiophen-3-yl)-(2,3,4-trifluorophenyl)methyl]propan-1-amine (PubChem CID 105010456) has the molecular formula C14H13BrF3NS and a molecular weight of 364.23 g/mol. Its IUPAC name is N-[(4-bromothiophen-3-yl)-(2,3,4-trifluorophenyl)methyl]propan-1-amine.
| Compound Name | N-[(4-bromothiophen-3-yl)-(2,3,4-trifluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105010456 |
| Molecular Formula | C14H13BrF3NS |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | N-[(4-bromothiophen-3-yl)-(2,3,4-trifluorophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cscc1Br)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H13BrF3NS/c1-2-5-19-14(9-6-20-7-10(9)15)8-3-4-11(16)13(18)12(8)17/h3-4,6-7,14,19H,2,5H2,1H3 |
| InChIKey | IXJZJHDWPSIACH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|