C15H15BrF3NS — CID 79754639
N-[(3-bromo-5-methylthiophen-2-yl)-(2,3,4-trifluorophenyl)methyl]propan-1-amine (PubChem CID 79754639) has the molecular formula C15H15BrF3NS and a molecular weight of 378.26 g/mol. Its IUPAC name is N-[(3-bromo-5-methylthiophen-2-yl)-(2,3,4-trifluorophenyl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-5-methylthiophen-2-yl)-(2,3,4-trifluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 79754639 |
| Molecular Formula | C15H15BrF3NS |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | N-[(3-bromo-5-methylthiophen-2-yl)-(2,3,4-trifluorophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(F)c(F)c1F)c1sc(C)cc1Br |
| InChI | InChI=1S/C15H15BrF3NS/c1-3-6-20-14(15-10(16)7-8(2)21-15)9-4-5-11(17)13(19)12(9)18/h4-5,7,14,20H,3,6H2,1-2H3 |
| InChIKey | IHAZTBLAMRXPKO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|