C11H18BrNS — CID 65278886
1-(3-bromo-5-methylthiophen-2-yl)-N-propylpropan-1-amine (PubChem CID 65278886) has the molecular formula C11H18BrNS and a molecular weight of 276.24 g/mol. Its IUPAC name is 1-(3-bromo-5-methylthiophen-2-yl)-N-propylpropan-1-amine.
| Compound Name | 1-(3-bromo-5-methylthiophen-2-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 65278886 |
| Molecular Formula | C11H18BrNS |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 1-(3-bromo-5-methylthiophen-2-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1sc(C)cc1Br |
| InChI | InChI=1S/C11H18BrNS/c1-4-6-13-10(5-2)11-9(12)7-8(3)14-11/h7,10,13H,4-6H2,1-3H3 |
| InChIKey | SYWGVUVNOMOGNV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |