About 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine
1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine (PubChem CID 65279617) has the molecular formula C12H20BrNS
and a molecular weight of 290.27 g/mol. Its IUPAC name is 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine.
Molecular Properties
| Compound Name | 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine |
| PubChem CID | 65279617 |
| Molecular Formula | C12H20BrNS |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine |
| SMILES | CNC(CC(C)(C)C)c1sc(C)cc1Br |
| InChI | InChI=1S/C12H20BrNS/c1-8-6-9(13)11(15-8)10(14-5)7-12(2,3)4/h6,10,14H,7H2,1-5H3 |
| InChIKey | NHMQENLNCXLDIV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine?
The IUPAC name of 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine (CID 65279617) is 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine.
What is the SMILES notation for 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine?
The canonical SMILES for 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine is CNC(CC(C)(C)C)c1sc(C)cc1Br.
What is the InChIKey of 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine?
The InChIKey is NHMQENLNCXLDIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20BrNS/c1-8-6-9(13)11(15-8)10(14-5)7-12(2,3)4/h6,10,14H,7H2,1-5H3.
What are the key properties of 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine?
1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine has a molecular weight of 290.27 g/mol, XLogP of 4.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromo-5-methylthiophen-2-yl)-N,3,3-trimethylbutan-1-amine is sourced from PubChem (CID 65279617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).