C14H19N3O3 — CID 10516798
[1-(2-amino-1,1-dideuterioethyl)piperidin-4-yl]-(4-nitrophenyl)methanone (PubChem CID 10516798) has the molecular formula C14H19N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is [1-(2-amino-1,1-dideuterioethyl)piperidin-4-yl]-(4-nitrophenyl)methanone.
| Compound Name | [1-(2-amino-1,1-dideuterioethyl)piperidin-4-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 10516798 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | [1-(2-amino-1,1-dideuterioethyl)piperidin-4-yl]-(4-nitrophenyl)methanone |
| SMILES | [2H]C([2H])(CN)N1CCC(C(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C14H19N3O3/c15-7-10-16-8-5-12(6-9-16)14(18)11-1-3-13(4-2-11)17(19)20/h1-4,12H,5-10,15H2/i10D2 |
| InChIKey | WPJPWWGJTFCROC-KBMKNGFXSA-N |
| XLogP | 1.45 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|