About 1-ethoxy-N,5-diethylheptan-4-amine
1-ethoxy-N,5-diethylheptan-4-amine (PubChem CID 105168474) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is 1-ethoxy-N,5-diethylheptan-4-amine.
Molecular Properties
| Compound Name | 1-ethoxy-N,5-diethylheptan-4-amine |
| PubChem CID | 105168474 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 1-ethoxy-N,5-diethylheptan-4-amine |
| SMILES | CCNC(CCCOCC)C(CC)CC |
| InChI | InChI=1S/C13H29NO/c1-5-12(6-2)13(14-7-3)10-9-11-15-8-4/h12-14H,5-11H2,1-4H3 |
| InChIKey | RZZKKDARTZGQDF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-N,5-diethylheptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-N,5-diethylheptan-4-amine?
The IUPAC name of 1-ethoxy-N,5-diethylheptan-4-amine (CID 105168474) is 1-ethoxy-N,5-diethylheptan-4-amine.
What is the SMILES notation for 1-ethoxy-N,5-diethylheptan-4-amine?
The canonical SMILES for 1-ethoxy-N,5-diethylheptan-4-amine is CCNC(CCCOCC)C(CC)CC.
What is the InChIKey of 1-ethoxy-N,5-diethylheptan-4-amine?
The InChIKey is RZZKKDARTZGQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO/c1-5-12(6-2)13(14-7-3)10-9-11-15-8-4/h12-14H,5-11H2,1-4H3.
What are the key properties of 1-ethoxy-N,5-diethylheptan-4-amine?
1-ethoxy-N,5-diethylheptan-4-amine has a molecular weight of 215.38 g/mol, XLogP of 3.22, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-N,5-diethylheptan-4-amine is sourced from PubChem (CID 105168474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).