About N,5-diethylnonan-4-amine
N,5-diethylnonan-4-amine (PubChem CID 83051951) has the molecular formula C13H29N
and a molecular weight of 199.38 g/mol. Its IUPAC name is N,5-diethylnonan-4-amine.
Molecular Properties
| Compound Name | N,5-diethylnonan-4-amine |
| PubChem CID | 83051951 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | N,5-diethylnonan-4-amine |
| SMILES | CCCCC(CC)C(CCC)NCC |
| InChI | InChI=1S/C13H29N/c1-5-9-11-12(7-3)13(10-6-2)14-8-4/h12-14H,5-11H2,1-4H3 |
| InChIKey | RAQSCBNOLYAPQH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,5-diethylnonan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-diethylnonan-4-amine?
The IUPAC name of N,5-diethylnonan-4-amine (CID 83051951) is N,5-diethylnonan-4-amine.
What is the SMILES notation for N,5-diethylnonan-4-amine?
The canonical SMILES for N,5-diethylnonan-4-amine is CCCCC(CC)C(CCC)NCC.
What is the InChIKey of N,5-diethylnonan-4-amine?
The InChIKey is RAQSCBNOLYAPQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29N/c1-5-9-11-12(7-3)13(10-6-2)14-8-4/h12-14H,5-11H2,1-4H3.
What are the key properties of N,5-diethylnonan-4-amine?
N,5-diethylnonan-4-amine has a molecular weight of 199.38 g/mol, XLogP of 3.98, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-diethylnonan-4-amine is sourced from PubChem (CID 83051951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).