C17H35N — CID 114193299
1-cyclopentyl-N,4-diethyloctan-3-amine (PubChem CID 114193299) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is 1-cyclopentyl-N,4-diethyloctan-3-amine.
| Compound Name | 1-cyclopentyl-N,4-diethyloctan-3-amine |
|---|---|
| PubChem CID | 114193299 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | 1-cyclopentyl-N,4-diethyloctan-3-amine |
| SMILES | CCCCC(CC)C(CCC1CCCC1)NCC |
| InChI | InChI=1S/C17H35N/c1-4-7-12-16(5-2)17(18-6-3)14-13-15-10-8-9-11-15/h15-18H,4-14H2,1-3H3 |
| InChIKey | YQDFFTXALVFPNN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |