C16H33N — CID 105028198
1-cyclopentyl-N,5-diethylheptan-3-amine (PubChem CID 105028198) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is 1-cyclopentyl-N,5-diethylheptan-3-amine.
| Compound Name | 1-cyclopentyl-N,5-diethylheptan-3-amine |
|---|---|
| PubChem CID | 105028198 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 1-cyclopentyl-N,5-diethylheptan-3-amine |
| SMILES | CCNC(CCC1CCCC1)CC(CC)CC |
| InChI | InChI=1S/C16H33N/c1-4-14(5-2)13-16(17-6-3)12-11-15-9-7-8-10-15/h14-17H,4-13H2,1-3H3 |
| InChIKey | DFEBFXVKYCXZMM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |